C18H17ClN2O2 — CID 71699647
(3S)-N-[(1R)-8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydrofuro[2,3-b]pyridine-3-carboxamide (PubChem CID 71699647) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is (3S)-N-[(1R)-8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydrofuro[2,3-b]pyridine-3-carboxamide.
| Compound Name | (3S)-N-[(1R)-8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydrofuro[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71699647 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (3S)-N-[(1R)-8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydrofuro[2,3-b]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCc2cccc(Cl)c21)[C@@H]1COc2ncccc21 |
| InChI | InChI=1S/C18H17ClN2O2/c19-14-7-1-4-11-5-2-8-15(16(11)14)21-17(22)13-10-23-18-12(13)6-3-9-20-18/h1,3-4,6-7,9,13,15H,2,5,8,10H2,(H,21,22)/t13-,15-/m1/s1 |
| InChIKey | CZSOUAXANSQURS-UKRRQHHQSA-N |
| XLogP | 3.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |