C24H23N3O2S — CID 91949530
N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide (PubChem CID 91949530) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 91949530 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide |
| SMILES | O=C(NC1CCCc2ccccc21)C1CN(C(=O)c2cccs2)Cc2cccnc21 |
| InChI | InChI=1S/C24H23N3O2S/c28-23(26-20-10-3-7-16-6-1-2-9-18(16)20)19-15-27(24(29)21-11-5-13-30-21)14-17-8-4-12-25-22(17)19/h1-2,4-6,8-9,11-13,19-20H,3,7,10,14-15H2,(H,26,28) |
| InChIKey | YZFBWVMMQNSCGK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |