C24H23N5O2S — CID 91949462
N-(3-indazol-2-ylpropyl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide (PubChem CID 91949462) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-(3-indazol-2-ylpropyl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide.
| Compound Name | N-(3-indazol-2-ylpropyl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 91949462 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-(3-indazol-2-ylpropyl)-6-(thiophene-2-carbonyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide |
| SMILES | O=C(NCCCn1cc2ccccc2n1)C1CN(C(=O)c2cccs2)Cc2cccnc21 |
| InChI | InChI=1S/C24H23N5O2S/c30-23(26-11-5-12-29-15-17-6-1-2-8-20(17)27-29)19-16-28(24(31)21-9-4-13-32-21)14-18-7-3-10-25-22(18)19/h1-4,6-10,13,15,19H,5,11-12,14,16H2,(H,26,30) |
| InChIKey | VXMIGYXYQRBEPC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|