C17H19N3O4 — CID 91949384
6-(furan-2-carbonyl)-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide (PubChem CID 91949384) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 6-(furan-2-carbonyl)-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide.
| Compound Name | 6-(furan-2-carbonyl)-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 91949384 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 6-(furan-2-carbonyl)-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridine-8-carboxamide |
| SMILES | COCCNC(=O)C1CN(C(=O)c2ccco2)Cc2cccnc21 |
| InChI | InChI=1S/C17H19N3O4/c1-23-9-7-19-16(21)13-11-20(17(22)14-5-3-8-24-14)10-12-4-2-6-18-15(12)13/h2-6,8,13H,7,9-11H2,1H3,(H,19,21) |
| InChIKey | PWYBUGGSVWIPGP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|