C17H23N3O5 — CID 109132957
2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)cyclopropane-1-carboxamide (PubChem CID 109132957) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)cyclopropane-1-carboxamide.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 109132957 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)cyclopropane-1-carboxamide |
| SMILES | COCCNC(=O)C1CC1C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H23N3O5/c1-24-10-4-18-15(21)12-11-13(12)16(22)19-5-7-20(8-6-19)17(23)14-3-2-9-25-14/h2-3,9,12-13H,4-8,10-11H2,1H3,(H,18,21) |
| InChIKey | NRVOOHPSBFALIS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|