C19H27N3O4 — CID 109139132
2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(3-methylbutyl)cyclopropane-1-carboxamide (PubChem CID 109139132) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(3-methylbutyl)cyclopropane-1-carboxamide.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(3-methylbutyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 109139132 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-N-(3-methylbutyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)CCNC(=O)C1CC1C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-13(2)5-6-20-17(23)14-12-15(14)18(24)21-7-9-22(10-8-21)19(25)16-4-3-11-26-16/h3-4,11,13-15H,5-10,12H2,1-2H3,(H,20,23) |
| InChIKey | HTLRRMAUPVGOJP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |