C16H17Cl2N — CID 142874609
1,2-dichlorobenzene;(1S)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 142874609) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 1,2-dichlorobenzene;(1S)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 1,2-dichlorobenzene;(1S)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 142874609 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1,2-dichlorobenzene;(1S)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | Clc1ccccc1Cl.N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13N.C6H4Cl2/c11-10-7-3-5-8-4-1-2-6-9(8)10;7-5-3-1-2-4-6(5)8/h1-2,4,6,10H,3,5,7,11H2;1-4H/t10-;/m0./s1 |
| InChIKey | QXDXQENWRHGSJM-PPHPATTJSA-N |
| XLogP | 5.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |