C17H18ClNO — CID 107715792
3-chloro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline (PubChem CID 107715792) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 3-chloro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline.
| Compound Name | 3-chloro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline |
|---|---|
| PubChem CID | 107715792 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-chloro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline |
| SMILES | Nc1cccc(Cl)c1OCC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H18ClNO/c18-15-9-4-10-16(19)17(15)20-11-13-7-3-6-12-5-1-2-8-14(12)13/h1-2,4-5,8-10,13H,3,6-7,11,19H2 |
| InChIKey | JBCXTNGKSHRNAY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|