C19H18ClN — CID 116623661
4-chloro-1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)indole (PubChem CID 116623661) has the molecular formula C19H18ClN and a molecular weight of 295.81 g/mol. Its IUPAC name is 4-chloro-1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)indole.
| Compound Name | 4-chloro-1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)indole |
|---|---|
| PubChem CID | 116623661 |
| Molecular Formula | C19H18ClN |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-chloro-1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)indole |
| SMILES | Clc1cccc2c1ccn2CC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H18ClN/c20-18-9-4-10-19-17(18)11-12-21(19)13-15-7-3-6-14-5-1-2-8-16(14)15/h1-2,4-5,8-12,15H,3,6-7,13H2 |
| InChIKey | JOTCKWBCHBERRY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |