C17H17BrFNO — CID 63771567
3-bromo-5-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline (PubChem CID 63771567) has the molecular formula C17H17BrFNO and a molecular weight of 350.23 g/mol. Its IUPAC name is 3-bromo-5-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline.
| Compound Name | 3-bromo-5-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline |
|---|---|
| PubChem CID | 63771567 |
| Molecular Formula | C17H17BrFNO |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3-bromo-5-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline |
| SMILES | Nc1cc(F)cc(Br)c1OCC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H17BrFNO/c18-15-8-13(19)9-16(20)17(15)21-10-12-6-3-5-11-4-1-2-7-14(11)12/h1-2,4,7-9,12H,3,5-6,10,20H2 |
| InChIKey | ICMOYOMAWWSJMP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|