C18H18ClFO — CID 107691161
1-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 107691161) has the molecular formula C18H18ClFO and a molecular weight of 304.79 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 107691161 |
| Molecular Formula | C18H18ClFO |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Fc1cc(CCl)ccc1OCC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H18ClFO/c19-11-13-8-9-18(17(20)10-13)21-12-15-6-3-5-14-4-1-2-7-16(14)15/h1-2,4,7-10,15H,3,5-6,11-12H2 |
| InChIKey | MOEKCJMNKCEEQW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|