About 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine
6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine (PubChem CID 84721189) has the molecular formula C10H11ClFN
and a molecular weight of 199.66 g/mol. Its IUPAC name is 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine.
Analyze 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine?
The IUPAC name of 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine (CID 84721189) is 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine.
What is the SMILES notation for 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine?
The canonical SMILES for 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine is FC1CCNCc2cccc(Cl)c21.
What is the InChIKey of 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine?
The InChIKey is CWJXAOPZPODXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClFN/c11-8-3-1-2-7-6-13-5-4-9(12)10(7)8/h1-3,9,13H,4-6H2.
What are the key properties of 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine?
6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine has a molecular weight of 199.66 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine is sourced from PubChem (CID 84721189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).