C10H12FNO — CID 84718493
5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol (PubChem CID 84718493) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol.
| Compound Name | 5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol |
|---|---|
| PubChem CID | 84718493 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol |
| SMILES | Oc1cccc2c1CNCCC2F |
| InChI | InChI=1S/C10H12FNO/c11-9-4-5-12-6-8-7(9)2-1-3-10(8)13/h1-3,9,12-13H,4-6H2 |
| InChIKey | OYPPUWGLHCPZGJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|