C11H14FNO — CID 84720485
5-fluoro-5-methyl-1,2,3,4-tetrahydro-2-benzazepin-9-ol (PubChem CID 84720485) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 5-fluoro-5-methyl-1,2,3,4-tetrahydro-2-benzazepin-9-ol.
| Compound Name | 5-fluoro-5-methyl-1,2,3,4-tetrahydro-2-benzazepin-9-ol |
|---|---|
| PubChem CID | 84720485 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 5-fluoro-5-methyl-1,2,3,4-tetrahydro-2-benzazepin-9-ol |
| SMILES | CC1(F)CCNCc2c(O)cccc21 |
| InChI | InChI=1S/C11H14FNO/c1-11(12)5-6-13-7-8-9(11)3-2-4-10(8)14/h2-4,13-14H,5-7H2,1H3 |
| InChIKey | GKPGXAOUDKKEGE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|