C10H11FO — CID 84652361
1-fluoro-1-methyl-2,3-dihydroinden-4-ol (PubChem CID 84652361) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is 1-fluoro-1-methyl-2,3-dihydroinden-4-ol.
| Compound Name | 1-fluoro-1-methyl-2,3-dihydroinden-4-ol |
|---|---|
| PubChem CID | 84652361 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-fluoro-1-methyl-2,3-dihydroinden-4-ol |
| SMILES | CC1(F)CCc2c(O)cccc21 |
| InChI | InChI=1S/C10H11FO/c1-10(11)6-5-7-8(10)3-2-4-9(7)12/h2-4,12H,5-6H2,1H3 |
| InChIKey | FQQRMYKDMPXPLZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |