C10H11FOS — CID 84721000
4-fluoro-4-methyl-2,3-dihydrothiochromen-8-ol (PubChem CID 84721000) has the molecular formula C10H11FOS and a molecular weight of 198.26 g/mol. Its IUPAC name is 4-fluoro-4-methyl-2,3-dihydrothiochromen-8-ol.
| Compound Name | 4-fluoro-4-methyl-2,3-dihydrothiochromen-8-ol |
|---|---|
| PubChem CID | 84721000 |
| Molecular Formula | C10H11FOS |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 4-fluoro-4-methyl-2,3-dihydrothiochromen-8-ol |
| SMILES | CC1(F)CCSc2c(O)cccc21 |
| InChI | InChI=1S/C10H11FOS/c1-10(11)5-6-13-9-7(10)3-2-4-8(9)12/h2-4,12H,5-6H2,1H3 |
| InChIKey | WRCCMMPMCFYTKQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |