C10H12S2 — CID 142608887
4-methyl-2,3-dihydrothiochromene-4-thiol (PubChem CID 142608887) has the molecular formula C10H12S2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 4-methyl-2,3-dihydrothiochromene-4-thiol.
| Compound Name | 4-methyl-2,3-dihydrothiochromene-4-thiol |
|---|---|
| PubChem CID | 142608887 |
| Molecular Formula | C10H12S2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 4-methyl-2,3-dihydrothiochromene-4-thiol |
| SMILES | CC1(S)CCSc2ccccc21 |
| InChI | InChI=1S/C10H12S2/c1-10(11)6-7-12-9-5-3-2-4-8(9)10/h2-5,11H,6-7H2,1H3 |
| InChIKey | ZTTKQTPRWVPJCP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|