C12H15NO2S — CID 79848760
methyl 2-(4-amino-2,3-dihydrothiochromen-4-yl)acetate (PubChem CID 79848760) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is methyl 2-(4-amino-2,3-dihydrothiochromen-4-yl)acetate.
| Compound Name | methyl 2-(4-amino-2,3-dihydrothiochromen-4-yl)acetate |
|---|---|
| PubChem CID | 79848760 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | methyl 2-(4-amino-2,3-dihydrothiochromen-4-yl)acetate |
| SMILES | COC(=O)CC1(N)CCSc2ccccc21 |
| InChI | InChI=1S/C12H15NO2S/c1-15-11(14)8-12(13)6-7-16-10-5-3-2-4-9(10)12/h2-5H,6-8,13H2,1H3 |
| InChIKey | INWOTYLJJIWVIQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |