C11H13BrS — CID 172717703
4-bromo-4-ethyl-2,3-dihydrothiochromene (PubChem CID 172717703) has the molecular formula C11H13BrS and a molecular weight of 257.20 g/mol. Its IUPAC name is 4-bromo-4-ethyl-2,3-dihydrothiochromene.
| Compound Name | 4-bromo-4-ethyl-2,3-dihydrothiochromene |
|---|---|
| PubChem CID | 172717703 |
| Molecular Formula | C11H13BrS |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 4-bromo-4-ethyl-2,3-dihydrothiochromene |
| SMILES | CCC1(Br)CCSc2ccccc21 |
| InChI | InChI=1S/C11H13BrS/c1-2-11(12)7-8-13-10-6-4-3-5-9(10)11/h3-6H,2,7-8H2,1H3 |
| InChIKey | GBZAWWTVWAQCTP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|