C17H23NO2S — CID 60997344
ethyl 4-(cyclopentylamino)-2,3-dihydrothiochromene-4-carboxylate (PubChem CID 60997344) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is ethyl 4-(cyclopentylamino)-2,3-dihydrothiochromene-4-carboxylate.
| Compound Name | ethyl 4-(cyclopentylamino)-2,3-dihydrothiochromene-4-carboxylate |
|---|---|
| PubChem CID | 60997344 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | ethyl 4-(cyclopentylamino)-2,3-dihydrothiochromene-4-carboxylate |
| SMILES | CCOC(=O)C1(NC2CCCC2)CCSc2ccccc21 |
| InChI | InChI=1S/C17H23NO2S/c1-2-20-16(19)17(18-13-7-3-4-8-13)11-12-21-15-10-6-5-9-14(15)17/h5-6,9-10,13,18H,2-4,7-8,11-12H2,1H3 |
| InChIKey | CRTUJKYJVLHODI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |