C10H13NO — CID 84716941
1-amino-1-methyl-2,3-dihydroinden-4-ol (PubChem CID 84716941) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-amino-1-methyl-2,3-dihydroinden-4-ol.
| Compound Name | 1-amino-1-methyl-2,3-dihydroinden-4-ol |
|---|---|
| PubChem CID | 84716941 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-amino-1-methyl-2,3-dihydroinden-4-ol |
| SMILES | CC1(N)CCc2c(O)cccc21 |
| InChI | InChI=1S/C10H13NO/c1-10(11)6-5-7-8(10)3-2-4-9(7)12/h2-4,12H,5-6,11H2,1H3 |
| InChIKey | UNKKYZPUPXXMNZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |