C10H13NO — CID 51892318
[(1S)-1-amino-2,3-dihydroinden-1-yl]methanol (PubChem CID 51892318) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is [(1S)-1-amino-2,3-dihydroinden-1-yl]methanol.
| Compound Name | [(1S)-1-amino-2,3-dihydroinden-1-yl]methanol |
|---|---|
| PubChem CID | 51892318 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [(1S)-1-amino-2,3-dihydroinden-1-yl]methanol |
| SMILES | N[C@@]1(CO)CCc2ccccc21 |
| InChI | InChI=1S/C10H13NO/c11-10(7-12)6-5-8-3-1-2-4-9(8)10/h1-4,12H,5-7,11H2/t10-/m1/s1 |
| InChIKey | SHSCRKXSHFWZSL-SNVBAGLBSA-N |
| XLogP | 0.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |