About (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol
(1-propan-2-yl-2,3-dihydroinden-1-yl)methanol (PubChem CID 146230442) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol.
Molecular Properties
| Compound Name | (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol |
| PubChem CID | 146230442 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol |
| SMILES | CC(C)C1(CO)CCc2ccccc21 |
| InChI | InChI=1S/C13H18O/c1-10(2)13(9-14)8-7-11-5-3-4-6-12(11)13/h3-6,10,14H,7-9H2,1-2H3 |
| InChIKey | ILXVGJKICRLNRI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol?
The IUPAC name of (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol (CID 146230442) is (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol.
What is the SMILES notation for (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol?
The canonical SMILES for (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol is CC(C)C1(CO)CCc2ccccc21.
What is the InChIKey of (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol?
The InChIKey is ILXVGJKICRLNRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-10(2)13(9-14)8-7-11-5-3-4-6-12(11)13/h3-6,10,14H,7-9H2,1-2H3.
What are the key properties of (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol?
(1-propan-2-yl-2,3-dihydroinden-1-yl)methanol has a molecular weight of 190.29 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propan-2-yl-2,3-dihydroinden-1-yl)methanol is sourced from PubChem (CID 146230442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).