About methane;3-methyl-3-propan-2-yl-1,2-dihydroindene
methane;3-methyl-3-propan-2-yl-1,2-dihydroindene (PubChem CID 176568609) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is methane;3-methyl-3-propan-2-yl-1,2-dihydroindene.
Molecular Properties
| Compound Name | methane;3-methyl-3-propan-2-yl-1,2-dihydroindene |
| PubChem CID | 176568609 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | methane;3-methyl-3-propan-2-yl-1,2-dihydroindene |
| SMILES | C.CC(C)C1(C)CCc2ccccc21 |
| InChI | InChI=1S/C13H18.CH4/c1-10(2)13(3)9-8-11-6-4-5-7-12(11)13;/h4-7,10H,8-9H2,1-3H3;1H4 |
| InChIKey | UAINFCJDGICLGR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;3-methyl-3-propan-2-yl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methyl-3-propan-2-yl-1,2-dihydroindene?
The IUPAC name of methane;3-methyl-3-propan-2-yl-1,2-dihydroindene (CID 176568609) is methane;3-methyl-3-propan-2-yl-1,2-dihydroindene.
What is the SMILES notation for methane;3-methyl-3-propan-2-yl-1,2-dihydroindene?
The canonical SMILES for methane;3-methyl-3-propan-2-yl-1,2-dihydroindene is C.CC(C)C1(C)CCc2ccccc21.
What is the InChIKey of methane;3-methyl-3-propan-2-yl-1,2-dihydroindene?
The InChIKey is UAINFCJDGICLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18.CH4/c1-10(2)13(3)9-8-11-6-4-5-7-12(11)13;/h4-7,10H,8-9H2,1-3H3;1H4.
What are the key properties of methane;3-methyl-3-propan-2-yl-1,2-dihydroindene?
methane;3-methyl-3-propan-2-yl-1,2-dihydroindene has a molecular weight of 190.33 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methyl-3-propan-2-yl-1,2-dihydroindene is sourced from PubChem (CID 176568609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).