C13H18 — CID 145156021
3-methyl-3-propyl-1,2-dihydroindene (PubChem CID 145156021) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-methyl-3-propyl-1,2-dihydroindene.
| Compound Name | 3-methyl-3-propyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 145156021 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-methyl-3-propyl-1,2-dihydroindene |
| SMILES | CCCC1(C)CCc2ccccc21 |
| InChI | InChI=1S/C13H18/c1-3-9-13(2)10-8-11-6-4-5-7-12(11)13/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | KPANIPZGRMGZGA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |