C14H18O — CID 14963826
(1S)-1-propyl-3,4-dihydro-2H-naphthalene-1-carbaldehyde (PubChem CID 14963826) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (1S)-1-propyl-3,4-dihydro-2H-naphthalene-1-carbaldehyde.
| Compound Name | (1S)-1-propyl-3,4-dihydro-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 14963826 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1S)-1-propyl-3,4-dihydro-2H-naphthalene-1-carbaldehyde |
| SMILES | CCC[C@]1(C=O)CCCc2ccccc21 |
| InChI | InChI=1S/C14H18O/c1-2-9-14(11-15)10-5-7-12-6-3-4-8-13(12)14/h3-4,6,8,11H,2,5,7,9-10H2,1H3/t14-/m1/s1 |
| InChIKey | IYZMTQRZTDQAKY-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|