5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid

C14H18O3 — CID 115590590

IUPAC5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid
SMILESCCOC1(C(=O)O)CCCCc2ccccc21
InChIInChI=1S/C14H18O3/c1-2-17-14(13(15)16)10-6-5-8-11-7-3-4-9-12(11)14/h3-4,7,9H,2,5-6,8,10H2,1H3,(H,15,16)
InChIKeyHZJBHMZGBNSGNW-UHFFFAOYSA-N
MW234.29 g/mol
LogP2.73
Rot. Bonds3

About 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid

5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid (PubChem CID 115590590) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid.

Molecular Properties

Compound Name5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid
PubChem CID115590590
Molecular FormulaC14H18O3
Molecular Weight234.29 g/mol
Exact Mass234.13
IUPAC Name5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid
SMILESCCOC1(C(=O)O)CCCCc2ccccc21
InChIInChI=1S/C14H18O3/c1-2-17-14(13(15)16)10-6-5-8-11-7-3-4-9-12(11)14/h3-4,7,9H,2,5-6,8,10H2,1H3,(H,15,16)
InChIKeyHZJBHMZGBNSGNW-UHFFFAOYSA-N
XLogP2.73
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.29
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid?
The IUPAC name of 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid (CID 115590590) is 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid.
What is the SMILES notation for 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid?
The canonical SMILES for 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid is CCOC1(C(=O)O)CCCCc2ccccc21.
What is the InChIKey of 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid?
The InChIKey is HZJBHMZGBNSGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-2-17-14(13(15)16)10-6-5-8-11-7-3-4-9-12(11)14/h3-4,7,9H,2,5-6,8,10H2,1H3,(H,15,16).
What are the key properties of 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid?
5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid has a molecular weight of 234.29 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulene-5-carboxylic acid is sourced from PubChem (CID 115590590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).