C11H11ClO2 — CID 67733183
(1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid (PubChem CID 67733183) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
| Compound Name | (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 67733183 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(Cl)CCCc2ccccc21 |
| InChI | InChI=1S/C11H11ClO2/c12-11(10(13)14)7-3-5-8-4-1-2-6-9(8)11/h1-2,4,6H,3,5,7H2,(H,13,14)/t11-/m0/s1 |
| InChIKey | DOBJSPMUQWQREJ-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|