(1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid

C11H11ClO2 — CID 67733183

IUPAC(1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid
SMILESO=C(O)[C@]1(Cl)CCCc2ccccc21
InChIInChI=1S/C11H11ClO2/c12-11(10(13)14)7-3-5-8-4-1-2-6-9(8)11/h1-2,4,6H,3,5,7H2,(H,13,14)/t11-/m0/s1
InChIKeyDOBJSPMUQWQREJ-NSHDSACASA-N
MW210.66 g/mol
LogP2.54
Rot. Bonds1

About (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid

(1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid (PubChem CID 67733183) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid.

Molecular Properties

Compound Name(1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid
PubChem CID67733183
Molecular FormulaC11H11ClO2
Molecular Weight210.66 g/mol
Exact Mass210.04
IUPAC Name(1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid
SMILESO=C(O)[C@]1(Cl)CCCc2ccccc21
InChIInChI=1S/C11H11ClO2/c12-11(10(13)14)7-3-5-8-4-1-2-6-9(8)11/h1-2,4,6H,3,5,7H2,(H,13,14)/t11-/m0/s1
InChIKeyDOBJSPMUQWQREJ-NSHDSACASA-N
XLogP2.54
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.66
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The IUPAC name of (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CID 67733183) is (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
What is the SMILES notation for (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The canonical SMILES for (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid is O=C(O)[C@]1(Cl)CCCc2ccccc21.
What is the InChIKey of (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The InChIKey is DOBJSPMUQWQREJ-NSHDSACASA-N. The full InChI is InChI=1S/C11H11ClO2/c12-11(10(13)14)7-3-5-8-4-1-2-6-9(8)11/h1-2,4,6H,3,5,7H2,(H,13,14)/t11-/m0/s1.
What are the key properties of (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
(1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid has a molecular weight of 210.66 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-chloro-3,4-dihydro-2H-naphthalene-1-carboxylic acid is sourced from PubChem (CID 67733183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).