C12H15NO2 — CID 64663881
2-(1-amino-3,4-dihydro-2H-naphthalen-1-yl)acetic acid (PubChem CID 64663881) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(1-amino-3,4-dihydro-2H-naphthalen-1-yl)acetic acid.
| Compound Name | 2-(1-amino-3,4-dihydro-2H-naphthalen-1-yl)acetic acid |
|---|---|
| PubChem CID | 64663881 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(1-amino-3,4-dihydro-2H-naphthalen-1-yl)acetic acid |
| SMILES | NC1(CC(=O)O)CCCc2ccccc21 |
| InChI | InChI=1S/C12H15NO2/c13-12(8-11(14)15)7-3-5-9-4-1-2-6-10(9)12/h1-2,4,6H,3,5,7-8,13H2,(H,14,15) |
| InChIKey | BYZAMCPREYOJFF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |