About 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid
1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid (PubChem CID 114991852) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
Analyze 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The IUPAC name of 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CID 114991852) is 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
What is the SMILES notation for 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The canonical SMILES for 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid is CC(C)OC1(C(=O)O)CCCc2ccccc21.
What is the InChIKey of 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The InChIKey is PGZHCHWXESITPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-10(2)17-14(13(15)16)9-5-7-11-6-3-4-8-12(11)14/h3-4,6,8,10H,5,7,9H2,1-2H3,(H,15,16).
What are the key properties of 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid has a molecular weight of 234.30 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid is sourced from PubChem (CID 114991852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).