About 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde
1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde (PubChem CID 130640609) has the molecular formula C11H11ClO
and a molecular weight of 194.66 g/mol. Its IUPAC name is 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde |
| PubChem CID | 130640609 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde |
| SMILES | O=CC1(CCl)CCc2ccccc21 |
| InChI | InChI=1S/C11H11ClO/c12-7-11(8-13)6-5-9-3-1-2-4-10(9)11/h1-4,8H,5-7H2 |
| InChIKey | UUFLXWDBDSKLQS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde?
The IUPAC name of 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde (CID 130640609) is 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde.
What is the SMILES notation for 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde?
The canonical SMILES for 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde is O=CC1(CCl)CCc2ccccc21.
What is the InChIKey of 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde?
The InChIKey is UUFLXWDBDSKLQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO/c12-7-11(8-13)6-5-9-3-1-2-4-10(9)11/h1-4,8H,5-7H2.
What are the key properties of 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde?
1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde has a molecular weight of 194.66 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-2,3-dihydroindene-1-carbaldehyde is sourced from PubChem (CID 130640609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).