C14H16O — CID 22357444
spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-one (PubChem CID 22357444) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-one.
| Compound Name | spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 22357444 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-one |
| SMILES | O=C1CCC2(CC1)CCc1ccccc12 |
| InChI | InChI=1S/C14H16O/c15-12-6-9-14(10-7-12)8-5-11-3-1-2-4-13(11)14/h1-4H,5-10H2 |
| InChIKey | YKVYDPXSEBDAGJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |