C16H25N — CID 91126362
propane;spiro[1,2-dihydroindene-3,4'-piperidine] (PubChem CID 91126362) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is propane;spiro[1,2-dihydroindene-3,4'-piperidine].
| Compound Name | propane;spiro[1,2-dihydroindene-3,4'-piperidine] |
|---|---|
| PubChem CID | 91126362 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | propane;spiro[1,2-dihydroindene-3,4'-piperidine] |
| SMILES | CCC.c1ccc2c(c1)CCC21CCNCC1 |
| InChI | InChI=1S/C13H17N.C3H8/c1-2-4-12-11(3-1)5-6-13(12)7-9-14-10-8-13;1-3-2/h1-4,14H,5-10H2;3H2,1-2H3 |
| InChIKey | VTIZBEQLWOTNHP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |