C17H23NO — CID 10377780
1-[(4aR,10bR)-4a-methyl-1,2,3,4,5,6-hexahydrobenzo[f]isoquinolin-10b-yl]propan-1-one (PubChem CID 10377780) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[(4aR,10bR)-4a-methyl-1,2,3,4,5,6-hexahydrobenzo[f]isoquinolin-10b-yl]propan-1-one.
| Compound Name | 1-[(4aR,10bR)-4a-methyl-1,2,3,4,5,6-hexahydrobenzo[f]isoquinolin-10b-yl]propan-1-one |
|---|---|
| PubChem CID | 10377780 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-[(4aR,10bR)-4a-methyl-1,2,3,4,5,6-hexahydrobenzo[f]isoquinolin-10b-yl]propan-1-one |
| SMILES | CCC(=O)[C@@]12CCNC[C@]1(C)CCc1ccccc12 |
| InChI | InChI=1S/C17H23NO/c1-3-15(19)17-10-11-18-12-16(17,2)9-8-13-6-4-5-7-14(13)17/h4-7,18H,3,8-12H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | DATGEJYARVPBFC-IRXDYDNUSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |