C11H15NO2 — CID 126650795
5-methoxy-1,2,3,4-tetrahydro-3-benzazepin-5-ol (PubChem CID 126650795) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-methoxy-1,2,3,4-tetrahydro-3-benzazepin-5-ol.
| Compound Name | 5-methoxy-1,2,3,4-tetrahydro-3-benzazepin-5-ol |
|---|---|
| PubChem CID | 126650795 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 5-methoxy-1,2,3,4-tetrahydro-3-benzazepin-5-ol |
| SMILES | COC1(O)CNCCc2ccccc21 |
| InChI | InChI=1S/C11H15NO2/c1-14-11(13)8-12-7-6-9-4-2-3-5-10(9)11/h2-5,12-13H,6-8H2,1H3 |
| InChIKey | PMMUZSOFLDJLEJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|