About 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline
1,1-dimethoxy-3,4-dihydro-2H-isoquinoline (PubChem CID 66811083) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline.
Molecular Properties
| Compound Name | 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline |
| PubChem CID | 66811083 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline |
| SMILES | COC1(OC)NCCc2ccccc21 |
| InChI | InChI=1S/C11H15NO2/c1-13-11(14-2)10-6-4-3-5-9(10)7-8-12-11/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | MVJZWRRXDKDIIG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline?
The IUPAC name of 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline (CID 66811083) is 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline.
What is the SMILES notation for 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline?
The canonical SMILES for 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline is COC1(OC)NCCc2ccccc21.
What is the InChIKey of 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline?
The InChIKey is MVJZWRRXDKDIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-13-11(14-2)10-6-4-3-5-9(10)7-8-12-11/h3-6,12H,7-8H2,1-2H3.
What are the key properties of 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline?
1,1-dimethoxy-3,4-dihydro-2H-isoquinoline has a molecular weight of 193.25 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxy-3,4-dihydro-2H-isoquinoline is sourced from PubChem (CID 66811083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).