C10H10F3N — CID 172771527
1-(difluoromethyl)-1-fluoro-3,4-dihydro-2H-isoquinoline (PubChem CID 172771527) has the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. Its IUPAC name is 1-(difluoromethyl)-1-fluoro-3,4-dihydro-2H-isoquinoline.
| Compound Name | 1-(difluoromethyl)-1-fluoro-3,4-dihydro-2H-isoquinoline |
|---|---|
| PubChem CID | 172771527 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-(difluoromethyl)-1-fluoro-3,4-dihydro-2H-isoquinoline |
| SMILES | FC(F)C1(F)NCCc2ccccc21 |
| InChI | InChI=1S/C10H10F3N/c11-9(12)10(13)8-4-2-1-3-7(8)5-6-14-10/h1-4,9,14H,5-6H2 |
| InChIKey | NACUXNWSTRKHCA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|