C12H15N — CID 96851281
(3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine] (PubChem CID 96851281) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine].
| Compound Name | (3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine] |
|---|---|
| PubChem CID | 96851281 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine] |
| SMILES | c1ccc2c(c1)CC[C@@]21CCCN1 |
| InChI | InChI=1S/C12H15N/c1-2-5-11-10(4-1)6-8-12(11)7-3-9-13-12/h1-2,4-5,13H,3,6-9H2/t12-/m0/s1 |
| InChIKey | TUQGIUXQXXJESY-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |