C12H15NO — CID 175046084
(3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-ol (PubChem CID 175046084) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-ol.
| Compound Name | (3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-ol |
|---|---|
| PubChem CID | 175046084 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3R)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-ol |
| SMILES | Oc1cccc2c1[C@]1(CCCN1)CC2 |
| InChI | InChI=1S/C12H15NO/c14-10-4-1-3-9-5-7-12(11(9)10)6-2-8-13-12/h1,3-4,13-14H,2,5-8H2/t12-/m0/s1 |
| InChIKey | VWIDVCJQGYDPKZ-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|