C17H16O — CID 162403250
3,3'-spirobi[1,2-dihydroindene]-4-ol (PubChem CID 162403250) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is 3,3'-spirobi[1,2-dihydroindene]-4-ol.
| Compound Name | 3,3'-spirobi[1,2-dihydroindene]-4-ol |
|---|---|
| PubChem CID | 162403250 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3,3'-spirobi[1,2-dihydroindene]-4-ol |
| SMILES | Oc1cccc2c1C1(CCc3ccccc31)CC2 |
| InChI | InChI=1S/C17H16O/c18-15-7-3-5-13-9-11-17(16(13)15)10-8-12-4-1-2-6-14(12)17/h1-7,18H,8-11H2 |
| InChIKey | JFYBYWHQWQTSIH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |