C20H20 — CID 123687681
spiro[cyclohexene-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene] (PubChem CID 123687681) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is spiro[cyclohexene-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene].
| Compound Name | spiro[cyclohexene-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene] |
|---|---|
| PubChem CID | 123687681 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | spiro[cyclohexene-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene] |
| SMILES | C1=CCC2(CC1)c1ccccc1CCc1ccccc12 |
| InChI | InChI=1S/C20H20/c1-6-14-20(15-7-1)18-10-4-2-8-16(18)12-13-17-9-3-5-11-19(17)20/h1-6,8-11H,7,12-15H2 |
| InChIKey | YNQASOPLIQXBMR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|