C12H13NO — CID 105442633
spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one (PubChem CID 105442633) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one.
| Compound Name | spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 105442633 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one |
| SMILES | O=C1NCCC12CCc1ccccc12 |
| InChI | InChI=1S/C12H13NO/c14-11-12(7-8-13-11)6-5-9-3-1-2-4-10(9)12/h1-4H,5-8H2,(H,13,14) |
| InChIKey | RQYPVBAECSQSBD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |