About 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one
5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one (PubChem CID 105455179) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one.
Molecular Properties
| Compound Name | 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one |
| PubChem CID | 105455179 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one |
| SMILES | O=C1NCCC12CCc1ccc(O)cc12 |
| InChI | InChI=1S/C12H13NO2/c14-9-2-1-8-3-4-12(10(8)7-9)5-6-13-11(12)15/h1-2,7,14H,3-6H2,(H,13,15) |
| InChIKey | FUEAUFWPGDPFPM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one?
The IUPAC name of 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one (CID 105455179) is 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one.
What is the SMILES notation for 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one?
The canonical SMILES for 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one is O=C1NCCC12CCc1ccc(O)cc12.
What is the InChIKey of 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one?
The InChIKey is FUEAUFWPGDPFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c14-9-2-1-8-3-4-12(10(8)7-9)5-6-13-11(12)15/h1-2,7,14H,3-6H2,(H,13,15).
What are the key properties of 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one?
5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one has a molecular weight of 203.24 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one is sourced from PubChem (CID 105455179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).