About 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid
1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid (PubChem CID 105461504) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
Analyze 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The IUPAC name of 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CID 105461504) is 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
What is the SMILES notation for 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The canonical SMILES for 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid is O=C(O)C1(O)CCCc2ccc(O)cc21.
What is the InChIKey of 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The InChIKey is MSBLHEKZIZMMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c12-8-4-3-7-2-1-5-11(15,10(13)14)9(7)6-8/h3-4,6,12,15H,1-2,5H2,(H,13,14).
What are the key properties of 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid has a molecular weight of 208.21 g/mol, XLogP of 1.00, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydroxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid is sourced from PubChem (CID 105461504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).