C14H18O2 — CID 165352303
7-hydroxy-1,1,3,3-tetramethyl-4H-naphthalen-2-one (PubChem CID 165352303) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 7-hydroxy-1,1,3,3-tetramethyl-4H-naphthalen-2-one.
| Compound Name | 7-hydroxy-1,1,3,3-tetramethyl-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 165352303 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 7-hydroxy-1,1,3,3-tetramethyl-4H-naphthalen-2-one |
| SMILES | CC1(C)Cc2ccc(O)cc2C(C)(C)C1=O |
| InChI | InChI=1S/C14H18O2/c1-13(2)8-9-5-6-10(15)7-11(9)14(3,4)12(13)16/h5-7,15H,8H2,1-4H3 |
| InChIKey | NBDHLUPTGGOTOV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |