C12H12ClNO — CID 105478576
7-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one (PubChem CID 105478576) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 7-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one.
| Compound Name | 7-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 105478576 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 7-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2'-one |
| SMILES | O=C1NCCC12CCc1c(Cl)cccc12 |
| InChI | InChI=1S/C12H12ClNO/c13-10-3-1-2-9-8(10)4-5-12(9)6-7-14-11(12)15/h1-3H,4-7H2,(H,14,15) |
| InChIKey | OLUCURVSRFXGTE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |