About 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol
5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 115020894) has the molecular formula C11H13ClO
and a molecular weight of 196.68 g/mol. Its IUPAC name is 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol.
Molecular Properties
| Compound Name | 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol |
| PubChem CID | 115020894 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | CC1(O)CCCc2c(Cl)cccc21 |
| InChI | InChI=1S/C11H13ClO/c1-11(13)7-3-4-8-9(11)5-2-6-10(8)12/h2,5-6,13H,3-4,7H2,1H3 |
| InChIKey | VHVWFZVIBKEYQQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol?
The IUPAC name of 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol (CID 115020894) is 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol.
What is the SMILES notation for 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol?
The canonical SMILES for 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol is CC1(O)CCCc2c(Cl)cccc21.
What is the InChIKey of 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol?
The InChIKey is VHVWFZVIBKEYQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO/c1-11(13)7-3-4-8-9(11)5-2-6-10(8)12/h2,5-6,13H,3-4,7H2,1H3.
What are the key properties of 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol?
5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol has a molecular weight of 196.68 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol is sourced from PubChem (CID 115020894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).