C11H13ClO — CID 115020894
5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 115020894) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 115020894 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 5-chloro-1-methyl-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | CC1(O)CCCc2c(Cl)cccc21 |
| InChI | InChI=1S/C11H13ClO/c1-11(13)7-3-4-8-9(11)5-2-6-10(8)12/h2,5-6,13H,3-4,7H2,1H3 |
| InChIKey | VHVWFZVIBKEYQQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |