C18H19NO2 — CID 10660471
N-(5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalen-1-yl)benzamide (PubChem CID 10660471) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalen-1-yl)benzamide.
| Compound Name | N-(5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 10660471 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalen-1-yl)benzamide |
| SMILES | CC1(O)CCCc2c(NC(=O)c3ccccc3)cccc21 |
| InChI | InChI=1S/C18H19NO2/c1-18(21)12-6-9-14-15(18)10-5-11-16(14)19-17(20)13-7-3-2-4-8-13/h2-5,7-8,10-11,21H,6,9,12H2,1H3,(H,19,20) |
| InChIKey | DRNKZPRAWOVLHN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |