C13H16ClNO2 — CID 170356428
ethyl 2-[(1S)-1-amino-4-chloro-2,3-dihydroinden-1-yl]acetate (PubChem CID 170356428) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is ethyl 2-[(1S)-1-amino-4-chloro-2,3-dihydroinden-1-yl]acetate.
| Compound Name | ethyl 2-[(1S)-1-amino-4-chloro-2,3-dihydroinden-1-yl]acetate |
|---|---|
| PubChem CID | 170356428 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | ethyl 2-[(1S)-1-amino-4-chloro-2,3-dihydroinden-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(N)CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C13H16ClNO2/c1-2-17-12(16)8-13(15)7-6-9-10(13)4-3-5-11(9)14/h3-5H,2,6-8,15H2,1H3/t13-/m0/s1 |
| InChIKey | AKESAFAWLRAHKR-ZDUSSCGKSA-N |
| XLogP | 2.39 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |