C12H10O3 — CID 129374458
(3S)-spiro[1,2-dihydroindene-3,3'-oxolane]-2',5'-dione (PubChem CID 129374458) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is (3S)-spiro[1,2-dihydroindene-3,3'-oxolane]-2',5'-dione.
| Compound Name | (3S)-spiro[1,2-dihydroindene-3,3'-oxolane]-2',5'-dione |
|---|---|
| PubChem CID | 129374458 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (3S)-spiro[1,2-dihydroindene-3,3'-oxolane]-2',5'-dione |
| SMILES | O=C1C[C@]2(CCc3ccccc32)C(=O)O1 |
| InChI | InChI=1S/C12H10O3/c13-10-7-12(11(14)15-10)6-5-8-3-1-2-4-9(8)12/h1-4H,5-7H2/t12-/m0/s1 |
| InChIKey | JXJAHNQEJPFBPV-LBPRGKRZSA-N |
| XLogP | 1.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|